| Identification | |
| Name: | 2-Biphenylamine |
| Synonyms: | 2-Aminodiphenyl;(1,1'-Biphenyl)-2-amine;2-Aminobifenyl;2-Aminodiphenyl;o-Aminobiphenyl;o-Biphenylamine;Biphenyl-2-ylamine;BRN 0471874; |
| CAS: | 90-41-5 |
| EINECS: | 201-990-9 |
| Molecular Formula: | C12H11N |
| Molecular Weight: | 169.22 |
| InChI: | InChI=1/C12H11N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,13H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 299 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.613-1.615 |
| Water Solubility: | Slightly soluble (soluble in alcohol, ether and chloroform) |
| Solubility: | Sol in ethanol, ether, benzene; slightly sol in dimethylsulfoxide, petroleum ether Insol in water |
| Appearance: | colourless to purple crystalline solid |
| Specification: | colourless to purple crystalline solid usageEng:Has a mutagenic potency. Safety Statements:36/37-61 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| HS Code: | 29214980 |
| Color: | Leaflets (dilute alcohol) Colorless or purplish crystals |
| Usage: | Has a mutagenic potency. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
