| Identification | |
| Name: | Xanthone |
| Synonyms: | Xanthen-9-one(8CI);9-Oxoxanthene;9-Xanthone;9H-Xanthene, 9-oxo-;Benzophenone oxide;Dibenzo-g-pyrone;Diphenylene ketoneoxide;Genicide;Xanthenone;Xanthones; |
| CAS: | 90-47-1 |
| EINECS: | 201-997-7 |
| Molecular Formula: | C13H8O2 |
| Molecular Weight: | 196.2 |
| InChI: | InChI=1/C13H8O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Flash Point: | 169.8°C |
| Density: | 1.277 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.642 |
| Appearance: | off-white powder |
| Specification: |
Xanthone , with CAS number of 90-47-1, can be called 9-Oxoxanthene ; 9-Xanthenone ; 9-Xanthone ; 9H-Xanthene, 9-oxo- ; Benzophenone oxide ; Dibenzo-gamma-pyrone ; Diphenylene ketone oxide ; Xanthene, 9-oxo- ; Xanthenone . Xanthone (CAS NO.90-47-1) is used in the prepn of Xanthydrol with the appearance of off-white powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 169.8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
