| Identification | |
| Name: | 2-Propenoicacid, 3-(3,4,5-trimethoxyphenyl)- |
| Synonyms: | 2-10-00-00354 (Beilstein Handbook Reference);3,4,5-Trimethoxyphenylacrylic acid;3-(3,4,5-Trimethoxyphenyl)-2-propenoic acid;BRN 1537834;O-Methylsinapic acid;NSC 66175; |
| CAS: | 90-50-6 |
| EINECS: | 201-999-8 |
| Molecular Formula: | C12H14O5 |
| Molecular Weight: | 238.24 |
| InChI: | InChI=1/C12H14O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H,13,14)/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.209 g/cm3 |
| Appearance: | white to cream fine crystalline powder |
| Specification: | white to cream fine crystalline powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
