| Identification | |
| Name: | Racephedrine |
| Synonyms: | (R*,S*)-(+-)-alpha-(1-(Methylamino)ethyl)benzyl alcohol;Benzenemethanol, alpha-(1-(methylamino)ethyl)-, (R*,S*)-(+-)- (9CI);(+-)-Ephedrine;Benzenemethanol, alpha-((1R)-1-(methylamino)ethyl)-, (alphaS)-rel-;4-13-00-01881 (Beilstein Handbook Reference);2-methylamino-1-phenyl-propan-1-ol;Ephedrine dl-; |
| CAS: | 90-83-5 |
| Molecular Formula: | C10H15NO |
| Molecular Weight: | 165.2322 |
| InChI: | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 38.1 deg C |
| Flash Point: | 85.6°C |
| Boiling Point: | 255°Cat760mmHg |
| Density: | 1.015g/cm3 |
| Solubility: | 1 G DISSOLVES IN ABOUT 20 ML WATER, 0.2 ML ALC; SOL IN CHLOROFORM, ETHER, OILS Soluble in alcohol, ether, chloroform, and oils. Soluble in ethanol, benzene In water= 63,600 mg/L at 30 deg C |
| Flash Point: | 85.6°C |
| Color: | Waxy solid, crystals or granules White to colorless granules, pieces, or crystals Plates from water |
| Safety Data | |
 |
|
