| Identification |
| Name: | 4,4'-Dimethoxybenzophenone |
| Synonyms: | 4,4-Dimethoxy Benzophenone |
| CAS: | 90-96-0 |
| EINECS: | 202-028-0 |
| Molecular Formula: | C15H14O3 |
| Molecular Weight: | 242.27 |
| InChI: | InChI=1/C15H14O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.123 g/cm3 |
| Refractive index: | 1.557 |
| Appearance: | White powder crystalline |
| Specification: | white to light yellow crystal powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29145000 |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |