| Identification | |
| Name: | 4,4'-Dichlorobenzophenone |
| Synonyms: | Benzophenone,4,4'-dichloro- (6CI,8CI);p-Dichlorobenzophenone;Bis(4-chlorophenyl)ketone;Bis(4-chlorophenyl)methanone;Bis(p-chlorophenyl) ketone;DBP(degradation product);DCBP;DCBP (ketone);Di(4-chlorophenyl) ketone;Di(p-chlorophenyl) ketone;NSC 8787;p,p'-Dichlorobenzophenone;4,4'-Dichloro Benzophenone;Methanone,bis(4-chlorophenyl)-; |
| CAS: | 90-98-2 |
| EINECS: | 202-030-1 |
| Molecular Formula: | C13H8Cl2O |
| Molecular Weight: | 251.11 |
| InChI: | InChI=1/C13H8Cl2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 156.2 ºC |
| Density: | 1.311 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.603 |
| Appearance: | faintly yellow crystalline powder |
| Specification: | faintly yellow crystalline powder Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 156.2 ºC |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
