| Identification | |
| Name: | Chlorodiphenylmethane |
| Synonyms: | Benzhydrylchloride,98%; Diphenylmethyl chloride; 7-Chloro-1,3-Dihydro-5-(2-Fluorophenyl)-2-Nitromethylene-2H-1,4-Benzodiazepine; Benzhydryl chloride, (Chlorodiphenylmethane; Diphenylmethyl chloride); Benzhydryl chloride; alpha-Chlorodiphenylmethane; Benzene 1,1'-(chloromethylene)bis; Diphenylchloromethane; 1,1'-(Chloromethylene)bisbenzene |
| CAS: | 90-99-3 |
| EINECS: | 202-031-7 |
| Molecular Formula: | C13H11Cl |
| Molecular Weight: | 202.68 |
| InChI: | InChI=1/C13H11Cl/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Flash Point: | 127°C |
| Density: | 1.14 |
| Refractive index: | 1.594-1.597 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Clear colorless to yellow liquid |
| Specification: | Clear colorless to yellow liquid Safety Statements:26-36-24/25-45-36/37/39-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Flash Point: | 127°C |
| Color: | NEEDLES |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
