| Identification | |
| Name: | Ethene, 1,1-dichloro-,homopolymer |
| Synonyms: | 1,1-Dichloroethene homopolymer;Ethylene,1,1-dichloro-, homopolymer (5CI);Ethylene, 1,1-dichloro-, polymers (8CI);1,1-Dichloroethylene polymer;PVDC;Polyvinylidene chloride; |
| CAS: | 9002-85-1 |
| Molecular Formula: | (C2H2Cl2)n |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C2H2Cl2/c1-2(3)4/h1H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -122.5 deg C |
| Flash Point: | °C |
| Boiling Point: | 57.3°Cat760mmHg |
| Density: | 1.168g/cm3 |
| Stability: | Stability |
| Solubility: | 0.63 g/100 g water at 50 deg C (solubility at saturation vapor pressure) In water: 3.5 g/l at 4 deg C; 3.0 g/l at 16 deg C Soluble in ethanol, acetone, benzene, carbon tetrachloride; very soluble in ethyl ether, chloroform. In water, 2,420 mg/L at 25 deg C |
| Appearance: | solid |
| Specification: | solid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | °C |
| Color: | Colorless liquid Colorless liquid or gas (above 89 degrees F). |
| Safety Data | |
 |
|
