| Identification | |
| Name: | Poly(acrylamide) |
| Synonyms: | 2-Propenamide, homopolymerPAAPoly(acrylamide)Polystolon |
| CAS: | 9003-05-8 |
| Molecular Formula: | (C3H5NO)n |
| Molecular Weight: | 71.0785 |
| InChI: | InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >230 °F |
| Density: | 1.3 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, aluminium, copper, iron, iron salts |
| Refractive index: | n20/D 1.452 |
| Water Solubility: | SOLUBLE |
| Solubility: | soluble in water |
| Appearance: | white to faintly yellow granules |
| Specification: |
? PAA , with CAS number of 9003-05-8, can be called 2-Propenamide, homopolymer ; Acrylamide homopolymer ; Acrylamide, polymers ; Poly(2-propenamide) ; Polyacrylamide resin ; Superfloc 84 ; Polyacrylamide . It is a?white to faintly yellow granule. |
| Report: |
??PAA (CAS NO.9003-05-8) is reported in EPA TSCA Inventory. |
| Flash Point: | >230 °F |
| Storage Temperature: | Refrigerator |
| Color: | WHITE SOLID |
| Usage: | Thickening agent, suspending agent, production of uranium, additive to adhesives, permissible food additive. |
| Safety Data | |
 |
|
