| Identification | |
| Name: | Polyisobutylene |
| Synonyms: | Propene, 2-methyl-, polymers;1-Propene,-2-methyl-, homopolymer;2-Methyl-1-propene, homopolymer;Polyisobutene;2-Methylpropene polymer;HSDB 1260;Isobutene homopolymer;Isobutene polymer;Isobutylene homopolymer;Maxvis 2000;UNII-4GAS6381TX; |
| CAS: | 9003-27-4 |
| EINECS: | 204-066-3 |
| Molecular Formula: | (C4H8)n |
| Molecular Weight: | 56.1063 |
| InChI: | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | [Physical properties depend upon the numberof monomer units in the polymer] |
| Boiling Point: | -6.9 deg C |
| Density: | 0.93 |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.51 |
| Solubility: | Very soluble in ethanol and ether; soluble in benzene In water, 263 mg/l @ 25 deg C |
| Appearance: | colorless to light yellow viscoelastic material |
| Specification: |
Polyisobutylene (CAS NO.9003-27-4) is also called as 1-Propene,-2-methyl-, homopolymer ; 2-Methyl-1-propene, homopolymer ; Polyisobutene ; 2-Methylpropene polymer ; Isobutylene homopolymer ; Isobutylene polymer ; Isobutylene resin ; Polyisobutene ; Polyisobutylene ; Propene, 2-methyl-, polymers ; Poly(4+)isobutylene and so on. |
| Packinggroup: | Z01 |
| Color: | Easily liquefied gas |
| Safety Data | |
 |
|
