| Identification |
| Name: | Exponent of antioxidant AM |
| Synonyms: | 2-Propanone,polymerwithN-phenylbenzenamine;VANOX 13;VANOX AM;VANOX HT;VANOX SKT;VANOX ZS;3,5-DI-TERT-BUTYL-4-HYDROXY-HYDROCINNAMIC ACID TRIESTER OF 1,3,5-TRIS(2-HYDROXYETHYL)-S-TRIAZINE-2,4,6-(1H,3H,5H)-TRIONE;Diphenylamine-acetone condensate |
| CAS: | 9003-79-6 |
| EINECS: | 500-009-4 |
| Molecular Formula: | C15H17NO |
| Molecular Weight: | 227.30158 |
| InChI: | InChI=1S/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | g/cm3 |
| Water Solubility: | dissolving in acetone or various kinds of organic solvents,insoluble in water and alcohol |
| Solubility: | dissolving in acetone or various kinds of organic solvents,insoluble in water and alcohol |
| Appearance: | Green to brown granule or flakes |
| Safety Data |
| |
 |
