| Identification | |
| Name: | acetone; formaldehyde; N-phenylaniline |
| Synonyms: | 2-Propanone, polymer with formaldehyde and N-phenylbenzenamine;Formaldehyde, polymer with N-phenylbenzenamine and 2-propanone;formaldehyde, polymer with n-phenylbenzenamine and2-propanone;FORMALDEHYDE-DIPHENYLAMINE-ACETONE POLYMER);formaldehyde/ diphenylamine/ acetone copolymer |
| CAS: | 9003-80-9 |
| EINECS: | 500-011-5 |
| Molecular Formula: | C16H19NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H11N.C3H6O.CH2O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4;1-2/h1-10,13H;1-2H3;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 152.8°C |
| Boiling Point: | 302°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 152.8°C |
| Safety Data | |
 |
|
