Identification |
Name: | Sorbitan,monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
Synonyms: | Sorbitan, monolaurate, polyoxyethylene derivs. (8CI);Ahco 7596T;Alkamuls PSML 20;Alkamuls PSML 80/72; |
CAS: | 9005-64-5 |
EINECS: | 500-018-3 |
Molecular Formula: | Unspecified |
Molecular Weight: | 522.6692 |
InChI: | InChI=1/C32H60O10/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-30(36)40-25-24-37-27-29(39-22-19-34)32-28(38-21-18-33)26-31(42-32)41-23-20-35/h9-10,28-29,31-35H,2-8,11-27H2,1H3/b10-9+ |
Molecular Structure: |
|
Properties |
Transport: | 200kgs |
Density: | 1.106 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.4685-1.4715 |
Water Solubility: | 100 g/L |
Solubility: | (25 C) soluble |
Appearance: | pale yellow oily liquid |
Specification: | Yellow liquid Safety Statements:24/25-36/37/39-36-26 24/25:Avoid contact with skin and eyes 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
HS Code: | 34021300 |
Usage: | Adjuvant, soap/surfactant. |
Safety Data |
Hazard Symbols |
|
|
|