| Identification | |
| Name: | Carbomer |
| Synonyms: | Carbomere;Carbomero;Carbomerum;Carbopol;UNII-K679OBS311;Carboxypolymethylene resin; |
| CAS: | 9007-20-9 |
| EINECS: | 202-415-4 |
| Molecular Formula: | Unspecified |
| Molecular Weight: | 72.0626 |
| InChI: | InChI=1/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 3 |
| Melting Point: | 12.5 deg C |
| Density: | 1.063g/cm3 |
| Refractive index: | n20/D 1.442 |
| Solubility: | Miscible with alcohol, and ether Miscible with ethanol, ethyl ether; soluble in acetone, benzene, carbon tetrachloride Miscible with chloroform Miscible with water /1X10+6 mg/L/ at 25 deg C |
| Appearance: | White loose powder |
| Specification: | Safety Statements:53-45 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Color: | Volatile liquid Colorless liquid Colorless liquid or solid (below 55 degrees F) |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
