| Identification | |
| Name: | Glucagon |
| Synonyms: | Glucagonoid;Glukagon; HG-Factor; Hyperglycemic-glycogenolytic factor |
| CAS: | 9007-92-5 |
| EINECS: | 232-708-2 |
| Molecular Formula: | C153H226ClN43O49S |
| Molecular Weight: | 3460.23 |
| InChI: | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -15 deg C |
| Boiling Point: | 230 deg C at 760 mm Hg |
| Solubility: | Miscible in ether, acetone SOL IN 70% ETHANOL 1:2 AND IN MOST ORGANIC SOLVENTS Soluble in alcohol, ether, mineral oil, fixed oils; insoluble in water and glycerol Soluble in acetone, chloroform Solubility in alcohol: 1 mL in 3 mL 70% alcohol; remains in soln to 10 mL In water, 100 mg/L at 25 deg C |
| Storage Temperature: | 2-8°C |
| Color: | Colorless to pale-yellow, liquid oil Oily liquid |
| Safety Data | |
 |
|
