| Identification | |
| Name: | Chitosan |
| Synonyms: | Flonac C;Chitosan H;Marinkaito F 05N;Marinkaito F 05S;KW 5;TKS 250N;Sea Cure 123;FCM 117;SK 10 (polysaccharide);HC 1 (polysaccharide);North Chitosan MC 1;OTS 2;Sea Cure 143;SK 200;Sea Cure 340;HI-DENSITY CHITOSAN;Chitopearl BCW 3505;Chiton (molluscan common name)Chitopearl 3510;Chitopearl BCW 3507;Hiset KW 5;WOT Recovery Floc T;Kytex M;Sea Cure 243;Chitosan EL;Hydagen HCMF;Profloc 320; |
| CAS: | 9012-76-4 |
| EINECS: | 222-311-2 |
| Molecular Formula: | Unspecified |
| Molecular Weight: | 179.17112 |
| InChI: | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 88 deg C |
| Density: | 1.75g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.7 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | faintly beige solid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Claimed to have the ability to retain fats and cholesterol in the stomach. |
| Safety Data | |
 |
|
