| Identification | |
| Name: | Benzenemethanamine,3,5-difluoro- |
| Synonyms: | (3,5-Difluorophenyl)methanamine;3,5-Difluorobenzylamine; [(3,5-Difluorophenyl)methyl]amine |
| CAS: | 90390-27-5 |
| Molecular Formula: | C7H7F2N |
| Molecular Weight: | 143.13 |
| InChI: | InChI=1/C7H7F2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H,4,10H2 |
| Molecular Structure: | ![(C7H7F2N) (3,5-Difluorophenyl)methanamine;3,5-Difluorobenzylamine; [(3,5-Difluorophenyl)methyl]amine](https://img.guidechem.com/casimg/90390-27-5.gif) |
| Properties | |
| Transport: | UN 2735 |
| Flash Point: | 165? |
| Density: | 1.21 |
| Refractive index: | 1.491 |
| Appearance: | Colorless to yellow clear liquid |
| Specification: |
Removal in wastewater treatment of 3,5-Difluorobenzylamine (90390-27-5) can be stated as follows: |
| Packinggroup: | III |
| Flash Point: | 165? |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
