| Identification |
| Name: | 1-methylquinazoline-4(1H)-thione |
| Synonyms: | 1-Methyl-4(1H)-quinazolinethione |
| CAS: | 90418-00-1 |
| Molecular Formula: | C9H8N2S |
| Molecular Weight: | 176.2382 |
| InChI: | InChI=1/C9H8N2S/c1-11-6-10-9(12)7-4-2-3-5-8(7)11/h2-6H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 137.3°C |
| Boiling Point: | 303.4°C at 760 mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.66 |
| Flash Point: | 137.3°C |
| Safety Data |
| |
 |