| Identification |
| Name: | Octadecanoic acid, reaction products with diethylenetriamine, di-Me sulfate-quaternized |
| Synonyms: | Stearic acid, condensate with diethylenetriamine, product reacted with dimethyl sulfate;N-(2-aminoethyl)ethane-1,2-diamine; dimethyl sulfate; stearic acid |
| CAS: | 90459-62-4 |
| EINECS: | 291-707-5 |
| Molecular Formula: | C24H55N3O6S |
| Molecular Weight: | 513.775 |
| InChI: | InChI=1/C18H36O2.C4H13N3.C2H6O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-5-7(3,4)6-2/h2-17H2,1H3,(H,19,20);7H,1-6H2;1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data |
| |
 |
