| Identification | |
| Name: | Isoquinoline,5-methoxy- |
| Synonyms: | 5-Methoxyisoquinoline; |
| CAS: | 90806-58-9 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H9NO/c1-12-10-4-2-3-8-7-11-6-5-9(8)10/h2-7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.131 g/cm3 |
| Refractive index: | 1.611 |
| Specification: |
The 5-Methoxyisoquinoline, with the cas registry number 90806-58-9, is a kind of organic, and should be stored in the dry and cool environment. The molecular formula of the chemical is C10H9NO. The characteristics of this chemical are as followings: (1)ACD/LogP: 2.89; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 11; (6)ACD/BCF (pH 7.4): 16; (7)ACD/KOC (pH 5.5): 175; (8)ACD/KOC (pH 7.4): 247; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 22.12 Å2; (13)Index of Refraction: 1.611; (14)Molar Refractivity: 48.865 cm3; (15)Molar Volume: 140.775 cm3; (16)Polarizability: 19.372×10-24cm3; (17)Surface Tension: 43.689 dyne/cm; (18)Density: 1.131 g/cm3; (19)Flash Point: 108.428 °C; (20)Enthalpy of Vaporization: 51.388 kJ/mol; (21)Boiling Point: 295.593 °C at 760 mmHg; (22)Vapour Pressure: 0.003 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
