| Identification | |
| Name: | Butoxypentachlorobenzene |
| Synonyms: | Butoxypentachlorobenzene;CP 205;Benzene, butoxypentachloro-;Pentachlorophenyl butyl ether;Ether, butyl pentachlorophenyl (6CI,7CI);AC1L5BMS;1-butoxy-2,3,4,5,6-pentachlorobenzene;LS-29360;90842-58-3 |
| CAS: | 90842-58-3 |
| Molecular Formula: | C10H9Cl5O |
| Molecular Weight: | 322.4429 |
| InChI: | InChI=1/C10H9Cl5O/c1-2-3-4-16-10-8(14)6(12)5(11)7(13)9(10)15/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 130.9°C |
| Boiling Point: | 363.5°C at 760 mmHg |
| Density: | 1.447g/cm3 |
| Refractive index: | 1.553 |
| Specification: |
The extinguishing agent of Butoxypentachlorobenzene (CAS NO.90842-58-3) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 130.9°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
