| Identification | |
| Name: | 2,6-Dimethoxyphenol |
| Synonyms: | Pyrogallol 1,3-dimethyl ether~Syringol |
| CAS: | 91-10-1 |
| EINECS: | 202-041-1 |
| Molecular Formula: | C8H10O3 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C8H10O3/c1-10-6-4-3-5-7(11-2)8(6)9/h3-5,9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.134g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.522 |
| Solubility: | 2 g/100 mL (13 oC) |
| Appearance: | Gray to light brown solid. |
| Specification: |
?2,6-Dimethoxyphenol (91-10-1) is a dimethyl ether of pyrogallol. It is slightly soluble in water. It is a white or colourless crystal with woody medicinal rather dry odour. It is stable and should keep in a cool, well-ventilated place. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29095090 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Antibacterial food preservative. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
