| Identification | |
| Name: | 1,2-Dicyanobenzene |
| Synonyms: | Phthalonitrile; 1,2-Dicyanobenzene/Phthalonitrile; 2-Phthalodinitrile; Benzene-1,2-dicarbonitrile~1,2-Dicyanobenzene |
| CAS: | 91-15-6 |
| EINECS: | 202-044-8 |
| Molecular Formula: | C8H4N2 |
| Molecular Weight: | 128.13 |
| InChI: | InChI=1/C8H4N2/c9-5-7-3-1-2-4-8(7)6-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3439 |
| Density: | 1.24 |
| Stability: | Stable. Incompatible with strong bases, strong acids, strong oxidizing agents, strong reducing agents. |
| Refractive index: | 1.565 |
| Appearance: | off-white to tan powder |
| Packinggroup: | II |
| HS Code: | 29269095 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry area away from incompatible substances. |
| Color: | NEEDLES FROM WATER OR PETROLEUM ETHER Buff-colored crystals Faint grayish yellow |
| Usage: | Intermediate in organic synthesis, esp pigments & dyes, base material for high temp lubricants & coatings. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
