| Identification | |
| Name: | Decahydronaphthalene |
| Synonyms: | cis/trans-Decalin = Decahydronaphthalene; Decalin |
| CAS: | 91-17-8 |
| EINECS: | 202-046-9 |
| Molecular Formula: | C10H18 |
| Molecular Weight: | 138.25 |
| InChI: | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1147 |
| Density: | 0.896 |
| Stability: | Stable. Incompatible with oxidizing agents. Combustible. May form explosive peroxides. Heat and light accelerate peroxide formation. |
| Refractive index: | 1.474-1.476 |
| Water Solubility: | 6 mg/L at 20 ºC |
| Solubility: | 6 mg/L at 20 ºC |
| Appearance: | clear, colorless liquid |
| Packinggroup: | III |
| HS Code: | 29021990 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Keep under a nitrogen blanket. Store in a cool, dry, well-ventilated area away from incompatible substances. After opening, purge container with nitrogen before reclosing. Periodically test for peroxide formation on long-term storage. Addition of water or appropriate reducing materials will lessen peroxide formation. |
| Sensitive: | Hygroscopic |
| Color: | Clear colorless liquid Water-white liquid |
| Usage: | Solvent for naphthalene, fats, resins, oils, waxes, instead of turpentine in lacquers, shoe polishes, floor waxes, in motor fuel & lubricants, patent fuel in stoves. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
