| Identification |
| Name: | N-Phenylanthranilic acid |
| Synonyms: | Diphenylamine-2-carboxylic acid; N-Phenyl 2-Aminobenzoic Acid; Benzoic acid, 2-(phenylamino)-; N-Phenyl o-aminobenzoic acid |
| CAS: | 91-40-7 |
| EINECS: | 202-066-8 |
| Molecular Formula: | C13H11NO2 |
| Molecular Weight: | 213.23 |
| InChI: | InChI=1/C13H11NO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,(H,15,16) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs
|
| Flash Point: | 186.7°C |
| Density: | 1.269 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | insoluble
|
| Appearance: | White
to off-white crystalline powder |
| HS Code: | 29224995 |
| Flash Point: | 186.7°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Detection of vanadium in steel. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
