| Identification | |
| Name: | 2-Naphthalenethiol |
| Synonyms: | 2-Mercaptonaphthalene;2-Naphthyl mercaptan;2-Thionaphthol;NSC 4749;RPA 2;Renacit 1;Vulcamel TBN;b-Mercaptonaphthalene;b-Naphthalenethiol;b-Naphthyl mercaptan;b-Thionaphthol; |
| CAS: | 91-60-1 |
| EINECS: | 202-082-5 |
| Molecular Formula: | C10H8S |
| Molecular Weight: | 160.23 |
| InChI: | InChI=1/C10H8S/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.176 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.589-1.591 |
| Solubility: | Insoluble |
| Appearance: | Almost white to cream powder |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29309070 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Usage: | Used as a flavour additive in food industry. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
