| Identification | |
| Name: | 6-methyl-quinolin |
| Synonyms: | p-Methylquinoline ; FEMA 2744 ; 6-METHYL QUINOLINE ; P-TOLUQUINOLINE ; PARA METHYL QUINOLINE ; 6-METHYLQUINOLINE 98+% ; Quinoline, 6-methyl- ; 6-methy quinoline;6-Methyl-chinolin;Quinoline,6-methyl; Tolliquinoline,p; |
| CAS: | 91-62-3 |
| EINECS: | 202-084-6 |
| Molecular Formula: | C10H9N |
| Molecular Weight: | 143.18500 |
| InChI: | InChI=1/C10H9N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h2-7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.067 |
| Stability: | Stable under normal temperatures and pressures. Light sensitive. |
| Refractive index: | n20/D 1.614(lit.) |
| Water Solubility: | sparingly soluble |
| Solubility: | sparingly soluble |
| Appearance: | yellow liquid |
| Specification: |
6-Methylquinoline (91-62-3) should be stored in a cool, ventilated warehouse. Away from fire and heat sources,and prevent direct sunlight. |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| HS Code: | 29334990 |
| Storage Temperature: | Refrigerator (approx 4 C). Keep containers tightly closed. Store protected from light. Store in a cool, dry area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Color: | green-yellow |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
