| Identification | |
| Name: | Quinaldine |
| Synonyms: | 2-Methylquinoline; alpha-methylquinoline; chinaldine; quineline, 2-methyl; |
| CAS: | 91-63-4 |
| EINECS: | 202-085-1 |
| Molecular Formula: | C10H9N |
| Molecular Weight: | 143.19 |
| InChI: | InChI=1/C10H9N/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2-7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61848? |
| Density: | 1.058 |
| Stability: | Stable, but may be light sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.6108-1.6138 |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | PRACTICALLY INSOLUBLE |
| Appearance: | light yellow ( colourless) |
| HS Code: | 29334990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Usage: | Used to make dyes, pharmaceuticals and other chemicals. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
