| Identification | |
| Name: | Coumarin |
| Synonyms: | 2H-1-Benzopyran-2-one; COUMARINE; 1-Benzopyran-2-one; 1,2-Benzopyrone; Chromen-2-one; O-Oxy-Cinnamic Lactone |
| CAS: | 91-64-5 |
| EINECS: | 202-086-7 |
| Molecular Formula: | C9H6O2 |
| Molecular Weight: | 146.14 |
| InChI: | InChI=1/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kg |
| Density: | 0.935 |
| Refractive index: | 1.594 |
| Solubility: | Slightly soluble AUTOI |
| Appearance: | white crystalline solid |
| Specification: | WHITE CRYSTALS OR CRYSTALLINE POWDER usageEng:Pharmaceutic aid (flavor). Found in tonka beans, levender oil, woodruff, sweet clover. Safety Statements:36-36/37-26 36:Wear suitable protective clothing 36/37:Wear suitable protective clothing and gloves 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Storage Temperature: | Refrigerator |
| Color: | Orthorhombic, rectangular plates Colorless, crystals, flakes, or powder White crystals |
| Usage: | Pharmaceutic aid (flavor). Found in tonka beans, levender oil, woodruff, sweet clover. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
