| Identification | |
| Name: | N,N-Diethylaniline |
| Synonyms: | DEA; N,N-Diethyl aniline |
| CAS: | 91-66-7 |
| EINECS: | 202-088-8 |
| Molecular Formula: | C10H15N |
| Molecular Weight: | 149.23 |
| InChI: | InChI=1/C10H15N/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2432 |
| Density: | 0.938 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids. |
| Refractive index: | 1.541-1.543 |
| Solubility: | 1.4 g/100ml |
| Appearance: | Pale Yellow to Brown Liquid |
| Packinggroup: | III |
| Color: | Colorless to yellow liquid BROWN OILY LIQUID |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
