| Identification |
| Name: | Benzenamine,N,N-diethyl-3-methyl- |
| Synonyms: | m-Toluidine,N,N-diethyl- (6CI,7CI,8CI);1-(Diethylamino)-3-methylbenzene;3-(Diethylamino)-1-methylbenzene;3-(Diethylamino)toluene;3-(N,N-Diethylamino)toluene;3-Methyl-N,N-diethylaniline;N,N-Diethyl-3-methylaniline;N,N-Diethyl-m-methylaniline;NSC 96629;m-Methyl(diethylamino)benzene;m-Methyl-N,N-diethylaniline; |
| CAS: | 91-67-8 |
| EINECS: | 202-089-3 |
| Molecular Formula: | C11H17N |
| Molecular Weight: | 163.26 |
| InChI: | InChI=1/C11H17N/c1-4-12(5-2)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 190kgs |
| Density: | 0.92 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.535-1.537 |
| Appearance: | Clear To Amber Liquid Turning to darken on storage |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
