| Identification |
| Name: | 1H-Imidazole-2-methanamine,4,5-dihydro-N-phenyl-N-(phenylmethyl)- |
| Synonyms: | 2-Imidazoline,2-[(N-benzylanilino)methyl]- (8CI);2-[(N-Benzylanilino)methyl]-2-imidazoline;Allergan A;Antistine;Phenazoline; |
| CAS: | 91-75-8 |
| EINECS: | 202-094-0 |
| Molecular Formula: | C17H19N3 |
| Molecular Weight: | 265.39 |
| InChI: | InChI=1/C17H19N3/c1-3-7-15(8-4-1)13-20(14-17-18-11-12-19-17)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,18,19) |
| Molecular Structure: |
![(C17H19N3) 2-Imidazoline,2-[(N-benzylanilino)methyl]- (8CI);2-[(N-Benzylanilino)methyl]-2-imidazoline;Allergan ...](https://img1.guidechem.com/chem/e/dict/24/91-75-8.jpg) |
| Properties |
| Melting Point: | 159 |
| Boiling Point: | 210 - 220 (0.7 torr) |
| Density: | 1.188 g/cm3 |
| Stability: | No data. |
| Solubility: | Insoluble |
| Appearance: | Crystals. Odorless. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | White, crystalline powder |
| Usage: | Medication. |
| Safety Data |
| |
 |
