| Identification | |
| Name: | 5,8-Quinolinedione,6-(phenylamino)- |
| Synonyms: | 5,8-Dihydro-5,8-dioxo-6-(phenylamino)quinoline;6-Anilinoquinoline-5,8-quinone;Comr 2029;LY 83583; |
| CAS: | 91300-60-6 |
| Molecular Formula: | C15H10N2O2 |
| Molecular Weight: | 250.2521 |
| InChI: | InChI=1S/C15H10N2O2/c18-13-9-12(17-10-5-2-1-3-6-10)15(19)11-7-4-8-16-14(11)13/h1-9,17H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.4 g/cm3 |
| Refractive index: | 1.715 |
| Water Solubility: | 0.1 M HCl: 1 mg/mL |
| Solubility: | 0.1 M HCl: 1 mg/mL |
| Appearance: | solid |
| Specification: | Red-Brown Solid usageEng:Inhibits nitric-oxide-induced activation of soluble guanylate cyclase (IC50=2) in a dose-dependent and reversible manner. It blocks acetylcholine induced vasorelaxation. Also an inhibitor of antigen-induced leukotriene release Safety Statements:36/37 36/37:Wear suitable protective clothing and gloves |
| Storage Temperature: | 2-8°C |
| Color: | violet |
| Usage: | Inhibits nitric-oxide-induced activation of soluble guanylate cyclase (IC50=2) in a dose-dependent and reversible manner. It blocks acetylcholine induced vasorelaxation. Also an inhibitor of antigen-induced leukotriene release |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
