| Identification | |
| Name: | m-Terphenyl |
| Synonyms: | 1,3-Diphenylbenzene |
| CAS: | 92-06-8 |
| EINECS: | 202-122-1 |
| Molecular Formula: | C18H14 |
| Molecular Weight: | 230.3 |
| InChI: | InChI=1/C18H14/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16/h1-14H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Density: | 1.2 |
| Stability: | Stable. |
| Solubility: | Insoluble |
| Appearance: | Yellow solid |
| Specification: |
1,3-Diphenylbenzene , its cas register number is 92-06-8. It also can be called m-Diphenylbenzene ; m-Terphenyl ; and 1,1':3',1''-Terphenyl . |
| Packinggroup: | II; III |
| Storage Temperature: | Keep tightly closed. Store in a cool and dry place. |
| Color: | YELLOW NEEDLES FROM ALC Crumbly, wax-like flakes at room temperature and light amber liquids above the melting point /Commercial terphenyl mixtures/ Yellow solid. |
| Usage: | Terphenyl mixtures are used industrially as heat storage and transfer agents, as textile dye carriers, and as intermediates in the production of nonspreading lubricants. From 1960-1970, technical grade terphenyls were used as coolants for nuclear reactors, whereas contemporary use has been in solar-heating systems. Terphenyl mixtures. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
