| Identification |
| Name: | Benzaldehyde,4-(diethylamino)-2-methyl- |
| Synonyms: | o-Tolualdehyde,4-(diethylamino)- (6CI,8CI);2-Methyl-4-diethylaminobenzaldehyde;4-(Diethylamino)-2-methylbenzaldehyde;4-(Diethylamino)-o-tolualdehyde;NSC7208;p-(Diethylamino)-2-tolualdehyde; |
| CAS: | 92-14-8 |
| EINECS: | 202-130-5 |
| Molecular Formula: | C12H17NO |
| Molecular Weight: | 191.27 |
| InChI: | InChI=1/C12H17NO/c1-4-13(5-2)12-7-6-11(9-14)10(3)8-12/h6-9H,4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 81 - 83 |
| Density: | 1.015 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.565 |
| Appearance: | White crystals. |
| Packinggroup: | III |
| HS Code: | 28459010 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Safety Data |
| |
 |
