| Identification | |
| Name: | Naphthacene |
| Synonyms: | 2,3-Benzanthracene;2,3-Benzanthrene; Benz[b]anthracene; Chrysogen; Rubene; Tetracene; Tetracene(hydrocarbon) |
| CAS: | 92-24-0 |
| EINECS: | 202-138-9 |
| Molecular Formula: | C18H12 |
| Molecular Weight: | 228.30 |
| InChI: | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| Molecular Structure: | ![(C18H12) 2,3-Benzanthracene;2,3-Benzanthrene; Benz[b]anthracene; Chrysogen; Rubene; Tetracene; Tetracene(hydr...](https://img1.guidechem.com/chem/e/dict/160/92-24-0.jpg) |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Melting Point: | >300 °C(lit.) |
| Flash Point: | 209.1°C |
| Boiling Point: | 436.7°C at 760 mmHg |
| Density: | 1.19g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.771 |
| Specification: |
About Naphthacene (92-24-0),its appearance is orange powder.It is stable and incompatible with strong oxidizing agents,also,chemical stability occurs when a substance is in a (dynamic) chemical equilibrium with its environment. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 209.1°C |
| Usage: | p-Type organic conductor and OLED dopant. Sublimed grade for organic electronic device applications. |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
