| Identification | |
| Name: | N-Chloroethyl-N-Ethylaniline |
| Synonyms: | N-(2-chloroethyl)-N-ethylaniline; N-Ethyl-N-(2-chloroethyl)aniline; N-ethyl-N-chloroethyl aniline |
| CAS: | 92-49-9 |
| EINECS: | 202-159-3 |
| Molecular Formula: | C10H14ClN |
| Molecular Weight: | 183.68 |
| InChI: | InChI=1/C10H14ClN/c1-2-12(9-8-11)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 45.5-46.5 |
| Flash Point: | 110.8°C |
| Boiling Point: | 163 - 164 (42 torr) |
| Density: | 1.069g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.549 |
| Solubility: | Insoluble |
| Appearance: | Needles from alcohol. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 110.8°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | NEEDLES FROM ALCOHOL |
| Usage: | A metabolite of alkoxyaniline mustards in microsomal suspensions. |
| Safety Data | |
 |
|
