| Identification |
| Name: | 1-Phenylpiperazine |
| Synonyms: | N-Phenylpiperazine |
| CAS: | 92-54-6 |
| EINECS: | 202-165-6 |
| Molecular Formula: | C10H14N2 |
| Molecular Weight: | 162.23 |
| InChI: | InChI=1/C10H14N2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12/h1-5,11H,6-9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2922 |
| Density: | 1.062 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5865-1.5885 |
| Water Solubility: | Insoluble |
| Solubility: | Very soluble |
| Appearance: | clear to yellowish liquid |
| Packinggroup: | II |
| HS Code: | 29335995 |
| Storage Temperature: | Store in dark! |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
