| Identification | |
| Name: | 2H-1-Benzopyran-2-one,7-hydroxy-6-methoxy- |
| Synonyms: | Coumarin,7-hydroxy-6-methoxy- (8CI);6-Methoxy-7-hydroxycoumarin;6-Methylesculetin;6-O-Methylesculetin;7-Hydroxy-6-methoxy-2H-1-benzopyran-2-one;7-Hydroxy-6-methoxycoumarin;Buxuletin;Chrysatropic acid;Escopoletin;Esculetin 6-methyl ether;Gelseminic acid;Murrayetin;NSC 405647;Scopoletin;Scopoletine;Scopoletol;b-Methylesculetin; |
| CAS: | 92-61-5 |
| EINECS: | 202-171-9 |
| Molecular Formula: | C10H8O4 |
| Molecular Weight: | 192.17 |
| InChI: | InChI=1/C10H8O4/c1-13-9-4-6-2-3-10(12)14-8(6)5-7(9)11/h2-5,11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 200 - 207ºC |
| Flash Point: | 172.4ºC |
| Boiling Point: | 413.5ºC at 760 mmHg |
| Density: | 1.377 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.609 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | yellow to beige crystalline powder |
| Specification: |
2H-1-Benzopyran-2-one,7-hydroxy-6-methoxy- , with CAS number of 92-61-5, can be called 2H-1-Benzopyran-2-one, 7-hydroxy-6-methoxy-;6-Methoxy-7-hydroxycoumarin ; 6-Methylesculetin ; 6-O-Methylesculetin ; 7-hydroxy-6-methoxy-2h-1-benzopyran-2-on ; 7-hydroxy-6-methoxy-coumari ; beta-Methylesculetin ; Buxuletin .It is a crystalline Solid,can be used for cosmetics, topical formulations, and foods. |
| Flash Point: | 172.4ºC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | The aglucone of Scopolin. Used for cosmetics, topical formulations, and foods. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
