| Identification | |
| Name: | 4-Aminodiphenyl-d9 |
| Synonyms: | 4-Aminobiphenyl; p-aminophenylbenzene |
| CAS: | 92-67-1 |
| EINECS: | 202-177-1 |
| Molecular Formula: | C12H11N |
| Molecular Weight: | 169.22 |
| InChI: | InChI=1/C12H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,13H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.077g/cm3 |
| Stability: | Stable, but slowly reacts with oxygen in the air. Combustible. Incompatible with strong oxidizing agents, acids, acid anhydrides, acid chlorides. |
| Refractive index: | 1.619 |
| Water Solubility: | Slightly soluble (soluble in alcohol, ether and chloroform) |
| Solubility: | Sol in ethanol, ether, acetone Sol in chloroform Slightly sol in cold water; readily sol in hot water SOL IN LIPIDS |
| Appearance: | brownish yellow solid |
| Specification: | Brownish Yellow Solid usageEng:Induces chromosomal instability in human cancer cells. Safety Statements:53-45-36-26 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | I |
| Color: | Colorless crystals...turns purple on contact with air Leaflets from alcohol or water |
| Usage: | Induces chromosomal instability in human cancer cells. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
