| Identification | |
| Name: | Ethanone,1-[1,1'-biphenyl]-4-yl- |
| Synonyms: | 4-Phenylacetophenone;Acetophenone,4'-phenyl- (6CI,7CI,8CI);Acetophenone, p-phenyl- (4CI);(1-[1,1'-Biphenyl]-4-yl)ethanone;1,1'-Biphenyl-4-yl methyl ketone;1-(4-Phenylphenyl)ethanone;1-Acetyl-4-phenylbenzene;1-Biphenyl-4-ylethanone;4-Acetyl-1,1'-biphenyl;4-Biphenylyl methyl ketone;4-Ethanoylbiphenyl;4'-Phenylacetophenone;Methyl 4-biphenylyl ketone;NSC1875;p-Acetylbiphenyl;p-Phenylacetophenone;1-(1,1'-biphenyl-4-yl)ethanone;1-(4-Biphenylyl)ethanone;1-(Biphenyl-4-yl)ethanon;4-Acetylbiphenyl;4-biphenylcarboxaldehyde;ethanone, 1-[1,1'-biphenyl]-4-yl-; |
| CAS: | 92-91-1 |
| EINECS: | 202-202-6 |
| Molecular Formula: | C14H12O |
| Molecular Weight: | 196.25 |
| InChI: | InChI=1/C14H12O/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 0.93 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | white to yellowish powder |
| HS Code: | 29143900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols | |
 |
|
