| Identification | |
| Name: | 2-Chloroacrylonitrile |
| Synonyms: | - |
| CAS: | 920-37-6 |
| EINECS: | 213-055-2 |
| Molecular Formula: | C3H2ClN |
| Molecular Weight: | 87.51 |
| InChI: | InChI=1/C3H2ClN/c1-3(4)2-5/h1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3273 |
| Density: | 1.096 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.429-1.431 |
| Solubility: | Soluble |
| Appearance: | clear, yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. Cyanide and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
