| Identification | |
| Name: | 2-Propanone,1,1,3-trichloro- |
| Synonyms: | 1,1,3-Trichloro-2-propanone;a,a',a'-Trichloroacetone; |
| CAS: | 921-03-9 |
| EINECS: | 213-063-6 |
| Molecular Formula: | C3H3Cl3O |
| Molecular Weight: | 161.41 |
| InChI: | InChI=1S/C3H3Cl3O/c4-1-2(7)3(5)6/h3H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3390 |
| Melting Point: | 9-11 ºC(lit.) |
| Flash Point: | 79 ºC |
| Boiling Point: | 88-90 ºC76 mm Hg(lit.) |
| Density: | 1.512 |
| Refractive index: | n20/D 1.491 |
| Appearance: | colorless liquid |
| Specification: | Safety Statements:26-36/37/39-45-60-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Flash Point: | 79 ºC |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
N: Dangerous for the environment
|
 |
|
