| Identification | |
| Name: | Phosphoramidousdichloride, N,N-bis(1-methylethyl)- |
| Synonyms: | Phosphoramidousdichloride, bis(1-methylethyl)- (9CI);Phosphoramidous dichloride, diisopropyl-(7CI,8CI);(Diisopropylamino)dichlorophosphine;Bis(isopropyl)aminodichlorophosphine;Dichloro(diisopropylamido)phosphorus;Dichloro(diisopropylamino)phosphine;Dichloro-N,N-(diisopropylamino)phosphine;Diisopropylphosphoramidous dichloride;N,N-Diisopropylphosphoramidousdichloride; |
| CAS: | 921-26-6 |
| Molecular Formula: | C6H14Cl2NP |
| Molecular Weight: | 202.06 |
| InChI: | InChI=1/C6H14Cl2NP/c1-5(2)9(6(3)4)10(7)8/h5-6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2846 |
| Flash Point: | 66 °C |
| Boiling Point: | 209.7°C at 760 mmHg |
| Density: | 1.096 g/mL at 25 °C(lit.) |
| Stability: | Moisture Sensitive |
| Refractive index: | n20/D 1.485(lit.) |
| Appearance: | Colourless Oil |
| Specification: | Colourless Oil usageEng:A versatile phosphitylating agent for the phosphorylation of hydroxy amino acids and the preparation of protected phosphopeptides Safety Statements:15-26-27-36/37/39-45 15:Keep away from heat 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | I |
| Flash Point: | 66 °C |
| Storage Temperature: | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| Usage: | A versatile phosphitylating agent for the phosphorylation of hydroxy amino acids and the preparation of protected phosphopeptides |
| Safety Data | |
| Hazard Symbols |
E: Explosive
C: Corrosive
|
 |
|
