| Identification | |
| Name: | 1,3-Benzodioxole-5-ethanamine,N,a-dimethyl-, hydrochloride (1:1) |
| CAS: | 92279-84-0 |
| Molecular Formula: | C11H16ClNO2 |
| Molecular Weight: | 229.7 |
| InChI: | InChI=1/C11H15NO2.ClH/c1-8(12-2)5-9-3-4-10-11(6-9)14-7-13-10;/h3-4,6,8,12H,5,7H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Flash Point: | 11 °C |
| Boiling Point: | 283.4°C at 760 mmHg |
| Specification: | Safety Statements:26-27-36/37/39-45-36/37-16-7 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 16:Keep away from sources of ignition - No smoking 7:Keep container tightly closed |
| Biological Activity: | Hallucinogenic compound that inhibits 5-HT and dopamine uptake. |
| Flash Point: | 11 °C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
