| Identification |
| Name: | Iodixanol |
| Synonyms: | Iodixanolum;OptiPrep;Visipaque;5,5'-((2-Hydroxytrimethylene)bis(acetylimino))bis(N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodoisophthalamide);1,3-Benzenedicarboxamide, 5,5'-((2-hydroxy-1,3-propanediyl)bis(acetylimino))bis(N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-; |
| CAS: | 92339-11-2 |
| Molecular Formula: | C35H44I6N6O15 |
| Molecular Weight: | 1550.18 |
| InChI: | InChI=1/C35H44I6N6O15/c1-13(52)46(30-26(38)20(32(59)42-3-15(54)9-48)24(36)21(27(30)39)33(60)43-4-16(55)10-49)7-19(58)8-47(14(2)53)31-28(40)22(34(61)44-5-17(56)11-50)25(37)23(29(31)41)35(62)45-6-18(57)12-51/h15-19,48-51,54-58H,3-12H2,1-2H3,(H,42,59)(H,43,60)(H,44,61)(H,45,62) |
| Molecular Structure: |
 |
| Properties |
| Transport: | DS |
| Density: | 2.295 g/cm3 |
| Stability: | Stable and nont reactive. |
| Refractive index: | 1.751 |
| Solubility: | Miscible |
| Appearance: | off-white to white powder |
| Specification: |
Iodixanol , with CAS number of 92339-11-2, can be called 1,3-Benzenedicarboxamide, 5,5'-((2-hydroxy-1,3-propanediyl)bis(acetylimino))bis(N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodo- ; 5,5'-((2-Hydroxytrimethylene)bis(acetylimino))bis(N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodoisophthalamide) ; Iodixanolum .
|
| Storage Temperature: | Store in original container according to temperature stated on container and in package insert. |
| Usage: | Isolation of biological particles using centrifugation techniques. |
| Safety Data |
| |
 |