Identification |
Name: | 1-Butanamine,N-butyl-N-nitroso- |
Synonyms: | Dibutylamine,N-nitroso- (6CI,7CI,8CI); Di-n-butylnitrosamine; Dibutylnitrosamine;N,N-Di-n-butylnitrosamine; N,N-Dibutylnitrosamine;N-Butyl-N-nitroso-1-butanamine; N-Nitroso-N-di-n-butylamine;N-Nitrosodi-n-butylamine; N-Nitrosodibutylamine; NDBA; NSC 6830;Nitrosodibutylamine |
CAS: | 924-16-3 |
EINECS: | 213-101-1 |
Molecular Formula: | C8H18 N2 O |
Molecular Weight: | 158.2413 |
InChI: | InChI=1/C8H18N2O/c1-3-5-7-10(9-11)8-6-4-2/h3-8H2,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | 2810 |
Density: | 0.91 g/cm3 |
Refractive index: | 1.456 |
Specification: | Oil Safety Statements:45-36/37-24/25-23-53 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 24/25:Avoid contact with skin and eyes 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 53:Avoid exposure - obtain special instruction before use |
Packinggroup: | III |
Safety Data |
Hazard Symbols |
Xn: Harmful
T: Toxic
|
|
|