| Identification | ||
| Name: | N-Methylolacrylamide | |
| Synonyms: | Acrylamide,N-(hydroxymethyl)- (6CI,8CI); MH 100; MH 100 (amide); Monomethylolacrylamide;N-(Hydroxymethyl)acrylamide; N-MAM; N-MAM P; N-Methanolacrylamide;N-Methylolacrylamide; NMA 60; NSC 553; Rocagil BT; U-Ramin T 80 | |
| CAS: | 924-42-5 | |
| EINECS: | 213-103-2 | |
| Molecular Formula: | C4H7 N O2 | |
| Molecular Weight: | 101.1039 | |
| InChI: | InChI=1S/C4H7NO2/c1-2-4(7)5-3-6/h2,6H,1,3H2,(H,5,7) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 2810 | |
| Flash Point: | 146.2°C | |
| Boiling Point: | 318.1°Cat760mmHg | |
| Density: | 1.074 | |
| Stability: | No data. | |
| Refractive index: | n20/D 1.413 | |
| Water Solubility: | <0.1 g/100 mL at 20.5 ºC | |
| Solubility: | <0.1 g/100 mL at 20.5 ºC | |
| Appearance: | A colorless or yellow aqueous solution. | |
| Specification: | Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice | |
| Packinggroup: | Z01 | |
| Flash Point: | 146.2°C | |
| Storage Temperature: | Refrigerator | |
| Usage: | Proposed for use in sunscreen preparations. Reactive comonomer, starch modifier. | |
| Safety Data | ||
| Hazard Symbols |
Xn: Harmful
|
|
 |
||
