| Identification | |
| Name: | Nitrous acid,1-methylpropyl ester |
| Synonyms: | Nitrousacid, sec-butyl ester (8CI); sec-Butyl nitrite (6CI,7CI); 2-Butyl nitrite |
| CAS: | 924-43-6 |
| EINECS: | 213-104-8 |
| Molecular Formula: | C4H9 N O2 |
| Molecular Weight: | 103.14 |
| InChI: | InChI=1/C4H9NO2/c1-3-4(2)7-5-6/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2351 |
| Flash Point: | °C |
| Boiling Point: | 70.5°Cat760mmHg |
| Density: | 0.99g/cm3 |
| Refractive index: | 1.416 |
| Specification: |
sec-Butyl nitrite , its cas register number is 924-43-6. It also can be called Nitrous acid, 1-methylpropyl ester ; and Nitrous acid, sec-butyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xn: Harmful
|
 |
|
