| Identification | |
| Name: | Acetic acid, 2-oxo-,ethyl ester |
| Synonyms: | Aceticacid, oxo-, ethyl ester (9CI);Glyoxylic acid, ethyl ester (6CI,7CI,8CI);Ethyl 2-oxoacetate;Ethyl oxoacetate;NSC 49206;Oxoacetic acidethyl ester; |
| CAS: | 924-44-7 |
| EINECS: | 213-105-3 |
| Molecular Formula: | C4H6O3 |
| Molecular Weight: | 102.09 |
| InChI: | InChI=1/C4H6O3/c1-2-7-4(6)3-5/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1294 |
| Density: | 1.03 |
| Refractive index: | 1.4750 |
| Appearance: | Clear colorless to slightly yellow solution |
| Specification: |
Ethyl oxoacetate , its CAS NO. is 924-44-7, the synonyms are EINECS 213-105-3 ; NSC 49206 ; Acetic acid, 2-oxo-, ethyl ester ; Acetic acid, oxo-, ethyl ester ; Ethyl glyoxylate . |
| Packinggroup: | II |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
